C24H28NO3P — CID 170420991
4-(2-diethoxyphosphorylethyl)-N,N-diphenylaniline (PubChem CID 170420991) has the molecular formula C24H28NO3P and a molecular weight of 409.47 g/mol. Its IUPAC name is 4-(2-diethoxyphosphorylethyl)-N,N-diphenylaniline.
| Compound Name | 4-(2-diethoxyphosphorylethyl)-N,N-diphenylaniline |
|---|---|
| PubChem CID | 170420991 |
| Molecular Formula | C24H28NO3P |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 4-(2-diethoxyphosphorylethyl)-N,N-diphenylaniline |
| SMILES | CCOP(=O)(CCc1ccc(N(c2ccccc2)c2ccccc2)cc1)OCC |
| InChI | InChI=1S/C24H28NO3P/c1-3-27-29(26,28-4-2)20-19-21-15-17-24(18-16-21)25(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-18H,3-4,19-20H2,1-2H3 |
| InChIKey | ONMCWMHWOTXJIH-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|