C21H30NO5PS — CID 11711848
[(2R)-2-amino-2-ethyl-4-[5-(5-phenylpentanoyl)thiophen-2-yl]butyl] dihydrogen phosphate (PubChem CID 11711848) has the molecular formula C21H30NO5PS and a molecular weight of 439.51 g/mol. Its IUPAC name is [(2R)-2-amino-2-ethyl-4-[5-(5-phenylpentanoyl)thiophen-2-yl]butyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-amino-2-ethyl-4-[5-(5-phenylpentanoyl)thiophen-2-yl]butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11711848 |
| Molecular Formula | C21H30NO5PS |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [(2R)-2-amino-2-ethyl-4-[5-(5-phenylpentanoyl)thiophen-2-yl]butyl] dihydrogen phosphate |
| SMILES | CC[C@@](N)(CCc1ccc(C(=O)CCCCc2ccccc2)s1)COP(=O)(O)O |
| InChI | InChI=1S/C21H30NO5PS/c1-2-21(22,16-27-28(24,25)26)15-14-18-12-13-20(29-18)19(23)11-7-6-10-17-8-4-3-5-9-17/h3-5,8-9,12-13H,2,6-7,10-11,14-16,22H2,1H3,(H2,24,25,26)/t21-/m1/s1 |
| InChIKey | OKAQZPIPIVOCOW-OAQYLSRUSA-N |
| XLogP | 4.49 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|