C21H31N2O5P — CID 10173336
[2-amino-4-[1-ethyl-5-(4-phenylbutanoyl)pyrrol-2-yl]-2-methylbutyl] dihydrogen phosphate (PubChem CID 10173336) has the molecular formula C21H31N2O5P and a molecular weight of 422.46 g/mol. Its IUPAC name is [2-amino-4-[1-ethyl-5-(4-phenylbutanoyl)pyrrol-2-yl]-2-methylbutyl] dihydrogen phosphate.
| Compound Name | [2-amino-4-[1-ethyl-5-(4-phenylbutanoyl)pyrrol-2-yl]-2-methylbutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10173336 |
| Molecular Formula | C21H31N2O5P |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | [2-amino-4-[1-ethyl-5-(4-phenylbutanoyl)pyrrol-2-yl]-2-methylbutyl] dihydrogen phosphate |
| SMILES | CCn1c(CCC(C)(N)COP(=O)(O)O)ccc1C(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C21H31N2O5P/c1-3-23-18(14-15-21(2,22)16-28-29(25,26)27)12-13-19(23)20(24)11-7-10-17-8-5-4-6-9-17/h4-6,8-9,12-13H,3,7,10-11,14-16,22H2,1-2H3,(H2,25,26,27) |
| InChIKey | OMWADJIYTIYPDT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|