C22H33N2O5P — CID 66672908
[2-amino-4-[5-[4-(3,5-dimethylphenyl)butanoyl]-1-methylpyrrol-2-yl]-2-methylbutyl] dihydrogen phosphate (PubChem CID 66672908) has the molecular formula C22H33N2O5P and a molecular weight of 436.49 g/mol. Its IUPAC name is [2-amino-4-[5-[4-(3,5-dimethylphenyl)butanoyl]-1-methylpyrrol-2-yl]-2-methylbutyl] dihydrogen phosphate.
| Compound Name | [2-amino-4-[5-[4-(3,5-dimethylphenyl)butanoyl]-1-methylpyrrol-2-yl]-2-methylbutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 66672908 |
| Molecular Formula | C22H33N2O5P |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [2-amino-4-[5-[4-(3,5-dimethylphenyl)butanoyl]-1-methylpyrrol-2-yl]-2-methylbutyl] dihydrogen phosphate |
| SMILES | Cc1cc(C)cc(CCCC(=O)c2ccc(CCC(C)(N)COP(=O)(O)O)n2C)c1 |
| InChI | InChI=1S/C22H33N2O5P/c1-16-12-17(2)14-18(13-16)6-5-7-21(25)20-9-8-19(24(20)4)10-11-22(3,23)15-29-30(26,27)28/h8-9,12-14H,5-7,10-11,15,23H2,1-4H3,(H2,26,27,28) |
| InChIKey | AFJONWJMTLDJQI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|