C21H30N2O2 — CID 11359833
1-[5-[(3R)-3-amino-4-hydroxy-3-methylbutyl]-1-methylpyrrol-2-yl]-5-phenylpentan-1-one (PubChem CID 11359833) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-[5-[(3R)-3-amino-4-hydroxy-3-methylbutyl]-1-methylpyrrol-2-yl]-5-phenylpentan-1-one.
| Compound Name | 1-[5-[(3R)-3-amino-4-hydroxy-3-methylbutyl]-1-methylpyrrol-2-yl]-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 11359833 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1-[5-[(3R)-3-amino-4-hydroxy-3-methylbutyl]-1-methylpyrrol-2-yl]-5-phenylpentan-1-one |
| SMILES | Cn1c(CC[C@@](C)(N)CO)ccc1C(=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C21H30N2O2/c1-21(22,16-24)15-14-18-12-13-19(23(18)2)20(25)11-7-6-10-17-8-4-3-5-9-17/h3-5,8-9,12-13,24H,6-7,10-11,14-16,22H2,1-2H3/t21-/m1/s1 |
| InChIKey | CMOPPWXVBAKYCO-OAQYLSRUSA-N |
| XLogP | 3.26 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|