C26H36N2O4 — CID 174479775
tert-butyl 3-amino-2-formyl-2-methyl-4-[1-methyl-5-(5-phenylpentanoyl)pyrrol-2-yl]butanoate (PubChem CID 174479775) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is tert-butyl 3-amino-2-formyl-2-methyl-4-[1-methyl-5-(5-phenylpentanoyl)pyrrol-2-yl]butanoate.
| Compound Name | tert-butyl 3-amino-2-formyl-2-methyl-4-[1-methyl-5-(5-phenylpentanoyl)pyrrol-2-yl]butanoate |
|---|---|
| PubChem CID | 174479775 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | tert-butyl 3-amino-2-formyl-2-methyl-4-[1-methyl-5-(5-phenylpentanoyl)pyrrol-2-yl]butanoate |
| SMILES | Cn1c(CC(N)C(C)(C=O)C(=O)OC(C)(C)C)ccc1C(=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C26H36N2O4/c1-25(2,3)32-24(31)26(4,18-29)23(27)17-20-15-16-21(28(20)5)22(30)14-10-9-13-19-11-7-6-8-12-19/h6-8,11-12,15-16,18,23H,9-10,13-14,17,27H2,1-5H3 |
| InChIKey | SZCLKDRRUWBTPA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|