About tert-butyl 3-phenylpropyl carbonate
tert-butyl 3-phenylpropyl carbonate (PubChem CID 24789021) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is tert-butyl 3-phenylpropyl carbonate.
Molecular Properties
| Compound Name | tert-butyl 3-phenylpropyl carbonate |
| PubChem CID | 24789021 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | tert-butyl 3-phenylpropyl carbonate |
| SMILES | CC(C)(C)OC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C14H20O3/c1-14(2,3)17-13(15)16-11-7-10-12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3 |
| InChIKey | ACQFXHBCDJFGGQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-phenylpropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-phenylpropyl carbonate?
The IUPAC name of tert-butyl 3-phenylpropyl carbonate (CID 24789021) is tert-butyl 3-phenylpropyl carbonate.
What is the SMILES notation for tert-butyl 3-phenylpropyl carbonate?
The canonical SMILES for tert-butyl 3-phenylpropyl carbonate is CC(C)(C)OC(=O)OCCCc1ccccc1.
What is the InChIKey of tert-butyl 3-phenylpropyl carbonate?
The InChIKey is ACQFXHBCDJFGGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-14(2,3)17-13(15)16-11-7-10-12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3.
What are the key properties of tert-butyl 3-phenylpropyl carbonate?
tert-butyl 3-phenylpropyl carbonate has a molecular weight of 236.31 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-phenylpropyl carbonate is sourced from PubChem (CID 24789021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).