About 3-(benzylamino)propyl tert-butyl carbonate
3-(benzylamino)propyl tert-butyl carbonate (PubChem CID 82533606) has the molecular formula C15H23NO3
and a molecular weight of 265.35 g/mol. Its IUPAC name is 3-(benzylamino)propyl tert-butyl carbonate.
Molecular Properties
| Compound Name | 3-(benzylamino)propyl tert-butyl carbonate |
| PubChem CID | 82533606 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3-(benzylamino)propyl tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)OCCCNCc1ccccc1 |
| InChI | InChI=1S/C15H23NO3/c1-15(2,3)19-14(17)18-11-7-10-16-12-13-8-5-4-6-9-13/h4-6,8-9,16H,7,10-12H2,1-3H3 |
| InChIKey | YXAJFKFXWNBXJU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(benzylamino)propyl tert-butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzylamino)propyl tert-butyl carbonate?
The IUPAC name of 3-(benzylamino)propyl tert-butyl carbonate (CID 82533606) is 3-(benzylamino)propyl tert-butyl carbonate.
What is the SMILES notation for 3-(benzylamino)propyl tert-butyl carbonate?
The canonical SMILES for 3-(benzylamino)propyl tert-butyl carbonate is CC(C)(C)OC(=O)OCCCNCc1ccccc1.
What is the InChIKey of 3-(benzylamino)propyl tert-butyl carbonate?
The InChIKey is YXAJFKFXWNBXJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-15(2,3)19-14(17)18-11-7-10-16-12-13-8-5-4-6-9-13/h4-6,8-9,16H,7,10-12H2,1-3H3.
What are the key properties of 3-(benzylamino)propyl tert-butyl carbonate?
3-(benzylamino)propyl tert-butyl carbonate has a molecular weight of 265.35 g/mol, XLogP of 3.12, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzylamino)propyl tert-butyl carbonate is sourced from PubChem (CID 82533606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).