C25H35N3O4 — CID 66941322
tert-butyl 2-amino-2-[4-[[4-(phenylmethoxycarbonylamino)butylamino]methyl]phenyl]acetate (PubChem CID 66941322) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is tert-butyl 2-amino-2-[4-[[4-(phenylmethoxycarbonylamino)butylamino]methyl]phenyl]acetate.
| Compound Name | tert-butyl 2-amino-2-[4-[[4-(phenylmethoxycarbonylamino)butylamino]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 66941322 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | tert-butyl 2-amino-2-[4-[[4-(phenylmethoxycarbonylamino)butylamino]methyl]phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)C(N)c1ccc(CNCCCCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H35N3O4/c1-25(2,3)32-23(29)22(26)21-13-11-19(12-14-21)17-27-15-7-8-16-28-24(30)31-18-20-9-5-4-6-10-20/h4-6,9-14,22,27H,7-8,15-18,26H2,1-3H3,(H,28,30) |
| InChIKey | KKROADUOFHIXCK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|