About 3-(benzylamino)propyl benzoate
3-(benzylamino)propyl benzoate (PubChem CID 67562495) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-(benzylamino)propyl benzoate.
Molecular Properties
| Compound Name | 3-(benzylamino)propyl benzoate |
| PubChem CID | 67562495 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-(benzylamino)propyl benzoate |
| SMILES | O=C(OCCCNCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c19-17(16-10-5-2-6-11-16)20-13-7-12-18-14-15-8-3-1-4-9-15/h1-6,8-11,18H,7,12-14H2 |
| InChIKey | WKOXLVSZWYTGAE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(benzylamino)propyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzylamino)propyl benzoate?
The IUPAC name of 3-(benzylamino)propyl benzoate (CID 67562495) is 3-(benzylamino)propyl benzoate.
What is the SMILES notation for 3-(benzylamino)propyl benzoate?
The canonical SMILES for 3-(benzylamino)propyl benzoate is O=C(OCCCNCc1ccccc1)c1ccccc1.
What is the InChIKey of 3-(benzylamino)propyl benzoate?
The InChIKey is WKOXLVSZWYTGAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c19-17(16-10-5-2-6-11-16)20-13-7-12-18-14-15-8-3-1-4-9-15/h1-6,8-11,18H,7,12-14H2.
What are the key properties of 3-(benzylamino)propyl benzoate?
3-(benzylamino)propyl benzoate has a molecular weight of 269.34 g/mol, XLogP of 3.02, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzylamino)propyl benzoate is sourced from PubChem (CID 67562495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).