C16H26N2O2 — CID 67596863
tert-butyl 2-amino-2-(4-phenylbutylamino)acetate (PubChem CID 67596863) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is tert-butyl 2-amino-2-(4-phenylbutylamino)acetate.
| Compound Name | tert-butyl 2-amino-2-(4-phenylbutylamino)acetate |
|---|---|
| PubChem CID | 67596863 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | tert-butyl 2-amino-2-(4-phenylbutylamino)acetate |
| SMILES | CC(C)(C)OC(=O)C(N)NCCCCc1ccccc1 |
| InChI | InChI=1S/C16H26N2O2/c1-16(2,3)20-15(19)14(17)18-12-8-7-11-13-9-5-4-6-10-13/h4-6,9-10,14,18H,7-8,11-12,17H2,1-3H3 |
| InChIKey | MPROHDKAGRCNRM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|