C32H47N2O7P — CID 66672919
tert-butyl N-[(2R)-1-bis(prop-2-enoxy)phosphoryloxy-2-methyl-4-[1-methyl-5-(5-phenylpentanoyl)pyrrol-2-yl]butan-2-yl]carbamate (PubChem CID 66672919) has the molecular formula C32H47N2O7P and a molecular weight of 602.71 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-bis(prop-2-enoxy)phosphoryloxy-2-methyl-4-[1-methyl-5-(5-phenylpentanoyl)pyrrol-2-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-bis(prop-2-enoxy)phosphoryloxy-2-methyl-4-[1-methyl-5-(5-phenylpentanoyl)pyrrol-2-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 66672919 |
| Molecular Formula | C32H47N2O7P |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | tert-butyl N-[(2R)-1-bis(prop-2-enoxy)phosphoryloxy-2-methyl-4-[1-methyl-5-(5-phenylpentanoyl)pyrrol-2-yl]butan-2-yl]carbamate |
| SMILES | C=CCOP(=O)(OCC=C)OC[C@@](C)(CCc1ccc(C(=O)CCCCc2ccccc2)n1C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H47N2O7P/c1-8-23-38-42(37,39-24-9-2)40-25-32(6,33-30(36)41-31(3,4)5)22-21-27-19-20-28(34(27)7)29(35)18-14-13-17-26-15-11-10-12-16-26/h8-12,15-16,19-20H,1-2,13-14,17-18,21-25H2,3-7H3,(H,33,36)/t32-/m1/s1 |
| InChIKey | JGNAQKBFPVXIHP-JGCGQSQUSA-N |
| XLogP | 7.37 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|