C25H32N2O3 — CID 66672612
[(2R)-2-acetamido-2-methyl-4-[1-methyl-5-(5-phenylpent-1-ynyl)pyrrol-2-yl]butyl] acetate (PubChem CID 66672612) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is [(2R)-2-acetamido-2-methyl-4-[1-methyl-5-(5-phenylpent-1-ynyl)pyrrol-2-yl]butyl] acetate.
| Compound Name | [(2R)-2-acetamido-2-methyl-4-[1-methyl-5-(5-phenylpent-1-ynyl)pyrrol-2-yl]butyl] acetate |
|---|---|
| PubChem CID | 66672612 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [(2R)-2-acetamido-2-methyl-4-[1-methyl-5-(5-phenylpent-1-ynyl)pyrrol-2-yl]butyl] acetate |
| SMILES | CC(=O)N[C@](C)(CCc1ccc(C#CCCCc2ccccc2)n1C)COC(C)=O |
| InChI | InChI=1S/C25H32N2O3/c1-20(28)26-25(3,19-30-21(2)29)18-17-24-16-15-23(27(24)4)14-10-6-9-13-22-11-7-5-8-12-22/h5,7-8,11-12,15-16H,6,9,13,17-19H2,1-4H3,(H,26,28)/t25-/m1/s1 |
| InChIKey | DAAOPMVHLIBRBZ-RUZDIDTESA-N |
| XLogP | 3.79 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|