C24H39NO3 — CID 10786582
[3-acetamido-3-methyl-5-(4-octylphenyl)pentyl] acetate (PubChem CID 10786582) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is [3-acetamido-3-methyl-5-(4-octylphenyl)pentyl] acetate.
| Compound Name | [3-acetamido-3-methyl-5-(4-octylphenyl)pentyl] acetate |
|---|---|
| PubChem CID | 10786582 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | [3-acetamido-3-methyl-5-(4-octylphenyl)pentyl] acetate |
| SMILES | CCCCCCCCc1ccc(CCC(C)(CCOC(C)=O)NC(C)=O)cc1 |
| InChI | InChI=1S/C24H39NO3/c1-5-6-7-8-9-10-11-22-12-14-23(15-13-22)16-17-24(4,25-20(2)26)18-19-28-21(3)27/h12-15H,5-11,16-19H2,1-4H3,(H,25,26) |
| InChIKey | XZWKFRXYLIMKDM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|