C25H39NO5 — CID 173282668
[2-acetamido-4-acetyloxy-2-methyl-4-(4-octylphenyl)butyl] acetate (PubChem CID 173282668) has the molecular formula C25H39NO5 and a molecular weight of 433.59 g/mol. Its IUPAC name is [2-acetamido-4-acetyloxy-2-methyl-4-(4-octylphenyl)butyl] acetate.
| Compound Name | [2-acetamido-4-acetyloxy-2-methyl-4-(4-octylphenyl)butyl] acetate |
|---|---|
| PubChem CID | 173282668 |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | [2-acetamido-4-acetyloxy-2-methyl-4-(4-octylphenyl)butyl] acetate |
| SMILES | CCCCCCCCc1ccc(C(CC(C)(COC(C)=O)NC(C)=O)OC(C)=O)cc1 |
| InChI | InChI=1S/C25H39NO5/c1-6-7-8-9-10-11-12-22-13-15-23(16-14-22)24(31-21(4)29)17-25(5,26-19(2)27)18-30-20(3)28/h13-16,24H,6-12,17-18H2,1-5H3,(H,26,27) |
| InChIKey | NUELKNDMDNELLA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|