C27H35NO5 — CID 143349457
[2-acetamido-2-(acetyloxymethyl)-4-[4-(4-phenylbutyl)phenyl]butyl] acetate (PubChem CID 143349457) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is [2-acetamido-2-(acetyloxymethyl)-4-[4-(4-phenylbutyl)phenyl]butyl] acetate.
| Compound Name | [2-acetamido-2-(acetyloxymethyl)-4-[4-(4-phenylbutyl)phenyl]butyl] acetate |
|---|---|
| PubChem CID | 143349457 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | [2-acetamido-2-(acetyloxymethyl)-4-[4-(4-phenylbutyl)phenyl]butyl] acetate |
| SMILES | CC(=O)NC(CCc1ccc(CCCCc2ccccc2)cc1)(COC(C)=O)COC(C)=O |
| InChI | InChI=1S/C27H35NO5/c1-21(29)28-27(19-32-22(2)30,20-33-23(3)31)18-17-26-15-13-25(14-16-26)12-8-7-11-24-9-5-4-6-10-24/h4-6,9-10,13-16H,7-8,11-12,17-20H2,1-3H3,(H,28,29) |
| InChIKey | NZKVTFXOJBUJRF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|