C52H66N2O10 — CID 160568930
[2-acetamido-2-(acetyloxymethyl)-4-[4-(5-phenylpentanoyl)phenyl]butyl] acetate;N-[1-hydroxy-2-(hydroxymethyl)-4-[4-(5-phenylpentanoyl)phenyl]butan-2-yl]acetamide (PubChem CID 160568930) has the molecular formula C52H66N2O10 and a molecular weight of 879.10 g/mol. Its IUPAC name is [2-acetamido-2-(acetyloxymethyl)-4-[4-(5-phenylpentanoyl)phenyl]butyl] acetate;N-[1-hydroxy-2-(hydroxymethyl)-4-[4-(5-phenylpentanoyl)phenyl]butan-2-yl]acetamide.
| Compound Name | [2-acetamido-2-(acetyloxymethyl)-4-[4-(5-phenylpentanoyl)phenyl]butyl] acetate;N-[1-hydroxy-2-(hydroxymethyl)-4-[4-(5-phenylpentanoyl)phenyl]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 160568930 |
| Molecular Formula | C52H66N2O10 |
| Molecular Weight | 879.10 g/mol |
| Exact Mass | 878.47 |
| IUPAC Name | [2-acetamido-2-(acetyloxymethyl)-4-[4-(5-phenylpentanoyl)phenyl]butyl] acetate;N-[1-hydroxy-2-(hydroxymethyl)-4-[4-(5-phenylpentanoyl)phenyl]butan-2-yl]acetamide |
| SMILES | CC(=O)NC(CCc1ccc(C(=O)CCCCc2ccccc2)cc1)(COC(C)=O)COC(C)=O.CC(=O)NC(CO)(CO)CCc1ccc(C(=O)CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H35NO6.C24H31NO4/c1-21(30)29-28(19-34-22(2)31,20-35-23(3)32)18-17-25-13-15-26(16-14-25)27(33)12-8-7-11-24-9-5-4-6-10-24;1-19(28)25-24(17-26,18-27)16-15-21-11-13-22(14-12-21)23(29)10-6-5-9-20-7-3-2-4-8-20/h4-6,9-10,13-16H,7-8,11-12,17-20H2,1-3H3,(H,29,30);2-4,7-8,11-14,26-27H,5-6,9-10,15-18H2,1H3,(H,25,28) |
| InChIKey | RAHIUABNHSEOAW-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 185.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.10 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|