C37H39NO5 — CID 69204346
9H-fluoren-9-ylmethyl N-[1-hydroxy-2-(hydroxymethyl)-4-[4-(5-phenylpentanoyl)phenyl]butan-2-yl]carbamate (PubChem CID 69204346) has the molecular formula C37H39NO5 and a molecular weight of 577.72 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[1-hydroxy-2-(hydroxymethyl)-4-[4-(5-phenylpentanoyl)phenyl]butan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[1-hydroxy-2-(hydroxymethyl)-4-[4-(5-phenylpentanoyl)phenyl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 69204346 |
| Molecular Formula | C37H39NO5 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[1-hydroxy-2-(hydroxymethyl)-4-[4-(5-phenylpentanoyl)phenyl]butan-2-yl]carbamate |
| SMILES | O=C(NC(CO)(CO)CCc1ccc(C(=O)CCCCc2ccccc2)cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H39NO5/c39-25-37(26-40,38-36(42)43-24-34-32-15-7-5-13-30(32)31-14-6-8-16-33(31)34)23-22-28-18-20-29(21-19-28)35(41)17-9-4-12-27-10-2-1-3-11-27/h1-3,5-8,10-11,13-16,18-21,34,39-40H,4,9,12,17,22-26H2,(H,38,42) |
| InChIKey | AWTPIVGRFLWPBB-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|