C28H27NO5 — CID 70010023
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-7-phenylheptanoic acid (PubChem CID 70010023) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-7-phenylheptanoic acid.
| Compound Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-7-phenylheptanoic acid |
|---|---|
| PubChem CID | 70010023 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-7-phenylheptanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C28H27NO5/c30-26(16-8-11-19-9-2-1-3-10-19)25(17-27(31)32)29-28(33)34-18-24-22-14-6-4-12-20(22)21-13-5-7-15-23(21)24/h1-7,9-10,12-15,24-25H,8,11,16-18H2,(H,29,33)(H,31,32)/t25-/m0/s1 |
| InChIKey | ODSYYQDYQVEKJG-VWLOTQADSA-N |
| XLogP | 4.96 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |