C21H18Cl3NO6 — CID 11386214
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(2,2,2-trichloroethoxy)butanoic acid (PubChem CID 11386214) has the molecular formula C21H18Cl3NO6 and a molecular weight of 486.74 g/mol. Its IUPAC name is (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(2,2,2-trichloroethoxy)butanoic acid.
| Compound Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(2,2,2-trichloroethoxy)butanoic acid |
|---|---|
| PubChem CID | 11386214 |
| Molecular Formula | C21H18Cl3NO6 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(2,2,2-trichloroethoxy)butanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H18Cl3NO6/c22-21(23,24)11-31-19(28)17(9-18(26)27)25-20(29)30-10-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11H2,(H,25,29)(H,26,27)/t17-/m0/s1 |
| InChIKey | LNYZAEXOCOOGMO-KRWDZBQOSA-N |
| XLogP | 4.28 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|