C25H24Cl3NO5 — CID 11734098
2,2,2-trichloroethyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-methylbut-3-yn-2-yloxy)propanoate (PubChem CID 11734098) has the molecular formula C25H24Cl3NO5 and a molecular weight of 524.83 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-methylbut-3-yn-2-yloxy)propanoate.
| Compound Name | 2,2,2-trichloroethyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-methylbut-3-yn-2-yloxy)propanoate |
|---|---|
| PubChem CID | 11734098 |
| Molecular Formula | C25H24Cl3NO5 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 2,2,2-trichloroethyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-methylbut-3-yn-2-yloxy)propanoate |
| SMILES | C#CC(C)(C)OC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C25H24Cl3NO5/c1-4-24(2,3)34-14-21(22(30)33-15-25(26,27)28)29-23(31)32-13-20-18-11-7-5-9-16(18)17-10-6-8-12-19(17)20/h1,5-12,20-21H,13-15H2,2-3H3,(H,29,31)/t21-/m0/s1 |
| InChIKey | VLQNGHUUKWFMCL-NRFANRHFSA-N |
| XLogP | 5.24 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|