C28H29NO4S — CID 102048599
S-phenyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanethioate (PubChem CID 102048599) has the molecular formula C28H29NO4S and a molecular weight of 475.61 g/mol. Its IUPAC name is S-phenyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanethioate.
| Compound Name | S-phenyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanethioate |
|---|---|
| PubChem CID | 102048599 |
| Molecular Formula | C28H29NO4S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | S-phenyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanethioate |
| SMILES | CC(C)(C)OC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C28H29NO4S/c1-28(2,3)33-18-25(26(30)34-19-11-5-4-6-12-19)29-27(31)32-17-24-22-15-9-7-13-20(22)21-14-8-10-16-23(21)24/h4-16,24-25H,17-18H2,1-3H3,(H,29,31)/t25-/m0/s1 |
| InChIKey | XNGBSQPRRLOCDM-VWLOTQADSA-N |
| XLogP | 6.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|