C43H42N2O6 — CID 51341432
[[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 51341432) has the molecular formula C43H42N2O6 and a molecular weight of 682.82 g/mol. Its IUPAC name is [[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | [[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 51341432 |
| Molecular Formula | C43H42N2O6 |
| Molecular Weight | 682.82 g/mol |
| Exact Mass | 682.30 |
| IUPAC Name | [[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | CNC(=O)c1ccc(C(OC(=O)[C@@H](COC(C)(C)C)NC(=O)OCC2c3ccccc3-c3ccccc32)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H42N2O6/c1-42(2,3)50-28-38(45-41(48)49-27-37-35-21-13-11-19-33(35)34-20-12-14-22-36(34)37)40(47)51-43(30-15-7-5-8-16-30,31-17-9-6-10-18-31)32-25-23-29(24-26-32)39(46)44-4/h5-26,37-38H,27-28H2,1-4H3,(H,44,46)(H,45,48)/t38-/m1/s1 |
| InChIKey | BDNUNRDRSUSBNG-KXQOOQHDSA-N |
| XLogP | 7.60 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.82 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|