C61H50N4O5 — CID 51341491
[[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoate (PubChem CID 51341491) has the molecular formula C61H50N4O5 and a molecular weight of 919.09 g/mol. Its IUPAC name is [[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoate.
| Compound Name | [[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 51341491 |
| Molecular Formula | C61H50N4O5 |
| Molecular Weight | 919.09 g/mol |
| Exact Mass | 918.38 |
| IUPAC Name | [[4-(methylcarbamoyl)phenyl]-diphenylmethyl] (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoate |
| SMILES | CNC(=O)c1ccc(C(OC(=O)[C@@H](Cc2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)NC(=O)OCC2c3ccccc3-c3ccccc32)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C61H50N4O5/c1-62-57(66)43-35-37-49(38-36-43)61(47-27-13-5-14-28-47,48-29-15-6-16-30-48)70-58(67)56(64-59(68)69-41-55-53-33-19-17-31-51(53)52-32-18-20-34-54(52)55)39-50-40-65(42-63-50)60(44-21-7-2-8-22-44,45-23-9-3-10-24-45)46-25-11-4-12-26-46/h2-38,40,42,55-56H,39,41H2,1H3,(H,62,66)(H,64,68)/t56-/m1/s1 |
| InChIKey | MRSHTNSFUKFITA-LXXIDKMWSA-N |
| XLogP | 11.07 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.09 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|