C40H33N3O4 — CID 54301529
9H-fluoren-9-ylmethoxycarbonyl (2S)-2-amino-3-(1-tritylimidazol-4-yl)propanoate (PubChem CID 54301529) has the molecular formula C40H33N3O4 and a molecular weight of 619.72 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethoxycarbonyl (2S)-2-amino-3-(1-tritylimidazol-4-yl)propanoate.
| Compound Name | 9H-fluoren-9-ylmethoxycarbonyl (2S)-2-amino-3-(1-tritylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 54301529 |
| Molecular Formula | C40H33N3O4 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | 9H-fluoren-9-ylmethoxycarbonyl (2S)-2-amino-3-(1-tritylimidazol-4-yl)propanoate |
| SMILES | N[C@@H](Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C(=O)OC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C40H33N3O4/c41-37(38(44)47-39(45)46-26-36-34-22-12-10-20-32(34)33-21-11-13-23-35(33)36)24-31-25-43(27-42-31)40(28-14-4-1-5-15-28,29-16-6-2-7-17-29)30-18-8-3-9-19-30/h1-23,25,27,36-37H,24,26,41H2/t37-/m0/s1 |
| InChIKey | SENSSXLFJVKEPE-QNGWXLTQSA-N |
| XLogP | 7.09 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|