C41H35N3O4 — CID 172529180
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-(1-tritylimidazol-4-yl)propanoic acid (PubChem CID 172529180) has the molecular formula C41H35N3O4 and a molecular weight of 633.75 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-(1-tritylimidazol-4-yl)propanoic acid.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-(1-tritylimidazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 172529180 |
| Molecular Formula | C41H35N3O4 |
| Molecular Weight | 633.75 g/mol |
| Exact Mass | 633.26 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-(1-tritylimidazol-4-yl)propanoic acid |
| SMILES | C[C@@](Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C41H35N3O4/c1-40(38(45)46,43-39(47)48-27-37-35-23-13-11-21-33(35)34-22-12-14-24-36(34)37)25-32-26-44(28-42-32)41(29-15-5-2-6-16-29,30-17-7-3-8-18-30)31-19-9-4-10-20-31/h2-24,26,28,37H,25,27H2,1H3,(H,43,47)(H,45,46)/t40-/m0/s1 |
| InChIKey | VVTFZPBWBSHIGR-FAIXQHPJSA-N |
| XLogP | 7.65 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.75 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|