C47H46N4O3 — CID 50941954
9H-fluoren-9-ylmethyl N-[(2S)-1-(cyclohexylmethylamino)-1-oxo-3-(1-tritylimidazol-4-yl)propan-2-yl]carbamate (PubChem CID 50941954) has the molecular formula C47H46N4O3 and a molecular weight of 714.91 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-(cyclohexylmethylamino)-1-oxo-3-(1-tritylimidazol-4-yl)propan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-(cyclohexylmethylamino)-1-oxo-3-(1-tritylimidazol-4-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 50941954 |
| Molecular Formula | C47H46N4O3 |
| Molecular Weight | 714.91 g/mol |
| Exact Mass | 714.36 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-(cyclohexylmethylamino)-1-oxo-3-(1-tritylimidazol-4-yl)propan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C(=O)NCC1CCCCC1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C47H46N4O3/c52-45(48-30-34-17-5-1-6-18-34)44(50-46(53)54-32-43-41-27-15-13-25-39(41)40-26-14-16-28-42(40)43)29-38-31-51(33-49-38)47(35-19-7-2-8-20-35,36-21-9-3-10-22-36)37-23-11-4-12-24-37/h2-4,7-16,19-28,31,33-34,43-44H,1,5-6,17-18,29-30,32H2,(H,48,52)(H,50,53)/t44-/m0/s1 |
| InChIKey | QEZKVZDJJAXMMC-SJARJILFSA-N |
| XLogP | 8.87 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.91 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|