C32H36N4O — CID 50942333
(2S)-2-amino-N-(cyclohexylmethyl)-3-(1-tritylimidazol-4-yl)propanamide (PubChem CID 50942333) has the molecular formula C32H36N4O and a molecular weight of 492.67 g/mol. Its IUPAC name is (2S)-2-amino-N-(cyclohexylmethyl)-3-(1-tritylimidazol-4-yl)propanamide.
| Compound Name | (2S)-2-amino-N-(cyclohexylmethyl)-3-(1-tritylimidazol-4-yl)propanamide |
|---|---|
| PubChem CID | 50942333 |
| Molecular Formula | C32H36N4O |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | (2S)-2-amino-N-(cyclohexylmethyl)-3-(1-tritylimidazol-4-yl)propanamide |
| SMILES | N[C@@H](Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C32H36N4O/c33-30(31(37)34-22-25-13-5-1-6-14-25)21-29-23-36(24-35-29)32(26-15-7-2-8-16-26,27-17-9-3-10-18-27)28-19-11-4-12-20-28/h2-4,7-12,15-20,23-25,30H,1,5-6,13-14,21-22,33H2,(H,34,37)/t30-/m0/s1 |
| InChIKey | VUPPQCAFYZOZRR-PMERELPUSA-N |
| XLogP | 5.29 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|