C37H42N2 — CID 22875205
4-[(E,2S)-6-cyclohexyl-2-cyclopropylhex-3-enyl]-1-tritylimidazole (PubChem CID 22875205) has the molecular formula C37H42N2 and a molecular weight of 514.76 g/mol. Its IUPAC name is 4-[(E,2S)-6-cyclohexyl-2-cyclopropylhex-3-enyl]-1-tritylimidazole.
| Compound Name | 4-[(E,2S)-6-cyclohexyl-2-cyclopropylhex-3-enyl]-1-tritylimidazole |
|---|---|
| PubChem CID | 22875205 |
| Molecular Formula | C37H42N2 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | 4-[(E,2S)-6-cyclohexyl-2-cyclopropylhex-3-enyl]-1-tritylimidazole |
| SMILES | C(=C/[C@@H](Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C1CC1)\CCC1CCCCC1 |
| InChI | InChI=1S/C37H42N2/c1-5-15-30(16-6-1)17-13-14-18-32(31-25-26-31)27-36-28-39(29-38-36)37(33-19-7-2-8-20-33,34-21-9-3-10-22-34)35-23-11-4-12-24-35/h2-4,7-12,14,18-24,28-32H,1,5-6,13,15-17,25-27H2/b18-14+/t32-/m0/s1 |
| InChIKey | WXRUXKTZMGBYSD-MQWMGDAPSA-N |
| XLogP | 9.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|