C18H28N2 — CID 70189592
5-[(Z)-6-cyclohexyl-2-cyclopropylhex-3-enyl]-1H-imidazole (PubChem CID 70189592) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 5-[(Z)-6-cyclohexyl-2-cyclopropylhex-3-enyl]-1H-imidazole.
| Compound Name | 5-[(Z)-6-cyclohexyl-2-cyclopropylhex-3-enyl]-1H-imidazole |
|---|---|
| PubChem CID | 70189592 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 5-[(Z)-6-cyclohexyl-2-cyclopropylhex-3-enyl]-1H-imidazole |
| SMILES | C(=C\C(Cc1cnc[nH]1)C1CC1)\CCC1CCCCC1 |
| InChI | InChI=1S/C18H28N2/c1-2-6-15(7-3-1)8-4-5-9-17(16-10-11-16)12-18-13-19-14-20-18/h5,9,13-17H,1-4,6-8,10-12H2,(H,19,20)/b9-5- |
| InChIKey | BFIZYPQIMSCSIZ-UITAMQMPSA-N |
| XLogP | 4.90 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|