C26H23N3O3 — CID 154197289
[1-oxo-3-(1-tritylimidazol-4-yl)propan-2-yl]carbamic acid (PubChem CID 154197289) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is [1-oxo-3-(1-tritylimidazol-4-yl)propan-2-yl]carbamic acid.
| Compound Name | [1-oxo-3-(1-tritylimidazol-4-yl)propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 154197289 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [1-oxo-3-(1-tritylimidazol-4-yl)propan-2-yl]carbamic acid |
| SMILES | O=CC(Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)NC(=O)O |
| InChI | InChI=1S/C26H23N3O3/c30-18-24(28-25(31)32)16-23-17-29(19-27-23)26(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,17-19,24,28H,16H2,(H,31,32) |
| InChIKey | GDRQVHIGXXSMEJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|