C26H26ClN3O2 — CID 53396006
methyl 2-amino-3-(1-tritylimidazol-4-yl)propanoate;hydrochloride (PubChem CID 53396006) has the molecular formula C26H26ClN3O2 and a molecular weight of 447.97 g/mol. Its IUPAC name is methyl 2-amino-3-(1-tritylimidazol-4-yl)propanoate;hydrochloride.
| Compound Name | methyl 2-amino-3-(1-tritylimidazol-4-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 53396006 |
| Molecular Formula | C26H26ClN3O2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | methyl 2-amino-3-(1-tritylimidazol-4-yl)propanoate;hydrochloride |
| SMILES | COC(=O)C(N)Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1.Cl |
| InChI | InChI=1S/C26H25N3O2.ClH/c1-31-25(30)24(27)17-23-18-29(19-28-23)26(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22;/h2-16,18-19,24H,17,27H2,1H3;1H |
| InChIKey | RSIWDQDVADNDKT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|