About methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate
methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate (PubChem CID 160550558) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate.
Molecular Properties
| Compound Name | methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate |
| PubChem CID | 160550558 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate |
| SMILES | C.COC(=O)[C@@H](N)Cc1cn(-c2ccccc2)cn1 |
| InChI | InChI=1S/C13H15N3O2.CH4/c1-18-13(17)12(14)7-10-8-16(9-15-10)11-5-3-2-4-6-11;/h2-6,8-9,12H,7,14H2,1H3;1H4/t12-;/m0./s1 |
| InChIKey | QXZWYVTYUJHIFQ-YDALLXLXSA-N |
| XLogP | 1.55 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate?
The IUPAC name of methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate (CID 160550558) is methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate.
What is the SMILES notation for methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate?
The canonical SMILES for methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate is C.COC(=O)[C@@H](N)Cc1cn(-c2ccccc2)cn1.
What is the InChIKey of methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate?
The InChIKey is QXZWYVTYUJHIFQ-YDALLXLXSA-N. The full InChI is InChI=1S/C13H15N3O2.CH4/c1-18-13(17)12(14)7-10-8-16(9-15-10)11-5-3-2-4-6-11;/h2-6,8-9,12H,7,14H2,1H3;1H4/t12-;/m0./s1.
What are the key properties of methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate?
methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate has a molecular weight of 261.32 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl (2S)-2-amino-3-(1-phenylimidazol-4-yl)propanoate is sourced from PubChem (CID 160550558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).