C13H13N5O6 — CID 57176735
methyl (2S)-2-amino-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanoate (PubChem CID 57176735) has the molecular formula C13H13N5O6 and a molecular weight of 335.28 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanoate.
| Compound Name | methyl (2S)-2-amino-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanoate |
|---|---|
| PubChem CID | 57176735 |
| Molecular Formula | C13H13N5O6 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | methyl (2S)-2-amino-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1cn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C13H13N5O6/c1-24-13(19)10(14)4-8-6-16(7-15-8)11-3-2-9(17(20)21)5-12(11)18(22)23/h2-3,5-7,10H,4,14H2,1H3/t10-/m0/s1 |
| InChIKey | GYGACLRHSFSWKW-JTQLQIEISA-N |
| XLogP | 0.73 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|