C12H10N4O7 — CID 85434662
3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-2-hydroxypropanoic acid (PubChem CID 85434662) has the molecular formula C12H10N4O7 and a molecular weight of 322.23 g/mol. Its IUPAC name is 3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-2-hydroxypropanoic acid.
| Compound Name | 3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 85434662 |
| Molecular Formula | C12H10N4O7 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-2-hydroxypropanoic acid |
| SMILES | O=C(O)C(O)Cc1cn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C12H10N4O7/c17-11(12(18)19)3-7-5-14(6-13-7)9-2-1-8(15(20)21)4-10(9)16(22)23/h1-2,4-6,11,17H,3H2,(H,18,19) |
| InChIKey | SLYYVZFLBLDRAT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 161.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|