C21H20N6O7 — CID 131716029
(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanoic acid (PubChem CID 131716029) has the molecular formula C21H20N6O7 and a molecular weight of 468.43 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 131716029 |
| Molecular Formula | C21H20N6O7 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanoic acid |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1cn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cn1)C(=O)O |
| InChI | InChI=1S/C21H20N6O7/c22-16(8-13-4-2-1-3-5-13)20(28)24-17(21(29)30)9-14-11-25(12-23-14)18-7-6-15(26(31)32)10-19(18)27(33)34/h1-7,10-12,16-17H,8-9,22H2,(H,24,28)(H,29,30)/t16-,17-/m0/s1 |
| InChIKey | IFZGGVIIEBQEMP-IRXDYDNUSA-N |
| XLogP | 1.37 |
| TPSA | 196.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|