C36H41N7O9 — CID 54015402
benzyl N-[(2S)-1-[[(2S)-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-1-[[(3S)-1-hydroxy-5-methylhexan-3-yl]amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 54015402) has the molecular formula C36H41N7O9 and a molecular weight of 715.76 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-1-[[(3S)-1-hydroxy-5-methylhexan-3-yl]amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-1-[[(3S)-1-hydroxy-5-methylhexan-3-yl]amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 54015402 |
| Molecular Formula | C36H41N7O9 |
| Molecular Weight | 715.76 g/mol |
| Exact Mass | 715.30 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-1-[[(3S)-1-hydroxy-5-methylhexan-3-yl]amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)C[C@@H](CCO)NC(=O)[C@H](Cc1cn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cn1)NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H41N7O9/c1-24(2)17-27(15-16-44)38-34(45)31(19-28-21-41(23-37-28)32-14-13-29(42(48)49)20-33(32)43(50)51)39-35(46)30(18-25-9-5-3-6-10-25)40-36(47)52-22-26-11-7-4-8-12-26/h3-14,20-21,23-24,27,30-31,44H,15-19,22H2,1-2H3,(H,38,45)(H,39,46)(H,40,47)/t27-,30+,31+/m1/s1 |
| InChIKey | KVHACMQWLUYHEV-RDAHNBDFSA-N |
| XLogP | 4.17 |
| TPSA | 220.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|