C30H36N6O9 — CID 54382069
benzyl (2S)-2-[[(2S)-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-4-methylpentanoate (PubChem CID 54382069) has the molecular formula C30H36N6O9 and a molecular weight of 624.65 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 54382069 |
| Molecular Formula | C30H36N6O9 |
| Molecular Weight | 624.65 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1cn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cn1)NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H36N6O9/c1-19(2)13-24(28(38)44-17-20-9-7-6-8-10-20)32-27(37)23(33-29(39)45-30(3,4)5)14-21-16-34(18-31-21)25-12-11-22(35(40)41)15-26(25)36(42)43/h6-12,15-16,18-19,23-24H,13-14,17H2,1-5H3,(H,32,37)(H,33,39)/t23-,24-/m0/s1 |
| InChIKey | VAPRUCXXMBUGQQ-ZEQRLZLVSA-N |
| XLogP | 4.40 |
| TPSA | 197.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|