C19H24N6O7 — CID 15673132
tert-butyl N-[(2S)-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-1-(ethylamino)-1-oxopropan-2-yl]carbamate (PubChem CID 15673132) has the molecular formula C19H24N6O7 and a molecular weight of 448.44 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-1-(ethylamino)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-1-(ethylamino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 15673132 |
| Molecular Formula | C19H24N6O7 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | tert-butyl N-[(2S)-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]-1-(ethylamino)-1-oxopropan-2-yl]carbamate |
| SMILES | CCNC(=O)[C@H](Cc1cn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cn1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24N6O7/c1-5-20-17(26)14(22-18(27)32-19(2,3)4)8-12-10-23(11-21-12)15-7-6-13(24(28)29)9-16(15)25(30)31/h6-7,9-11,14H,5,8H2,1-4H3,(H,20,26)(H,22,27)/t14-/m0/s1 |
| InChIKey | AGCILXHYPNPBPJ-AWEZNQCLSA-N |
| XLogP | 2.26 |
| TPSA | 171.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|