C19H18N6O5 — CID 87543176
(2S)-2-amino-N-benzyl-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanamide (PubChem CID 87543176) has the molecular formula C19H18N6O5 and a molecular weight of 410.39 g/mol. Its IUPAC name is (2S)-2-amino-N-benzyl-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanamide.
| Compound Name | (2S)-2-amino-N-benzyl-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanamide |
|---|---|
| PubChem CID | 87543176 |
| Molecular Formula | C19H18N6O5 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (2S)-2-amino-N-benzyl-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanamide |
| SMILES | N[C@@H](Cc1cn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cn1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H18N6O5/c20-16(19(26)21-10-13-4-2-1-3-5-13)8-14-11-23(12-22-14)17-7-6-15(24(27)28)9-18(17)25(29)30/h1-7,9,11-12,16H,8,10,20H2,(H,21,26)/t16-/m0/s1 |
| InChIKey | PZVNBZYHZVVWES-INIZCTEOSA-N |
| XLogP | 1.87 |
| TPSA | 159.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|