C21H19F3N6O7 — CID 87543175
(2S)-2-amino-N-benzyl-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanamide;2,2,2-trifluoroacetic acid (PubChem CID 87543175) has the molecular formula C21H19F3N6O7 and a molecular weight of 524.41 g/mol. Its IUPAC name is (2S)-2-amino-N-benzyl-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-amino-N-benzyl-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87543175 |
| Molecular Formula | C21H19F3N6O7 |
| Molecular Weight | 524.41 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | (2S)-2-amino-N-benzyl-3-[1-(2,4-dinitrophenyl)imidazol-4-yl]propanamide;2,2,2-trifluoroacetic acid |
| SMILES | N[C@@H](Cc1cn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cn1)C(=O)NCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H18N6O5.C2HF3O2/c20-16(19(26)21-10-13-4-2-1-3-5-13)8-14-11-23(12-22-14)17-7-6-15(24(27)28)9-18(17)25(29)30;3-2(4,5)1(6)7/h1-7,9,11-12,16H,8,10,20H2,(H,21,26);(H,6,7)/t16-;/m0./s1 |
| InChIKey | KWADQFNPKWPOEF-NTISSMGPSA-N |
| XLogP | 2.51 |
| TPSA | 196.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|