C33H25N7O7 — CID 10009204
benzyl N-[1-[[1-(2,4-dinitrophenyl)imidazol-4-yl]methyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamate (PubChem CID 10009204) has the molecular formula C33H25N7O7 and a molecular weight of 631.61 g/mol. Its IUPAC name is benzyl N-[1-[[1-(2,4-dinitrophenyl)imidazol-4-yl]methyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[[1-(2,4-dinitrophenyl)imidazol-4-yl]methyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 10009204 |
| Molecular Formula | C33H25N7O7 |
| Molecular Weight | 631.61 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | benzyl N-[1-[[1-(2,4-dinitrophenyl)imidazol-4-yl]methyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamate |
| SMILES | O=C(NC1N=C(c2ccccc2)c2ccccc2N(Cc2cn(-c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cn2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H25N7O7/c41-32-31(36-33(42)47-20-22-9-3-1-4-10-22)35-30(23-11-5-2-6-12-23)26-13-7-8-14-27(26)38(32)19-24-18-37(21-34-24)28-16-15-25(39(43)44)17-29(28)40(45)46/h1-18,21,31H,19-20H2,(H,36,42) |
| InChIKey | OTNFNAWYNYLYRK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 175.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|