C29H23N3O3 — CID 53326563
(3S)-3-benzyl-1-[(3-nitrophenyl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 53326563) has the molecular formula C29H23N3O3 and a molecular weight of 461.52 g/mol. Its IUPAC name is (3S)-3-benzyl-1-[(3-nitrophenyl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | (3S)-3-benzyl-1-[(3-nitrophenyl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 53326563 |
| Molecular Formula | C29H23N3O3 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | (3S)-3-benzyl-1-[(3-nitrophenyl)methyl]-5-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | O=C1[C@H](Cc2ccccc2)N=C(c2ccccc2)c2ccccc2N1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H23N3O3/c33-29-26(19-21-10-3-1-4-11-21)30-28(23-13-5-2-6-14-23)25-16-7-8-17-27(25)31(29)20-22-12-9-15-24(18-22)32(34)35/h1-18,26H,19-20H2/t26-/m0/s1 |
| InChIKey | XZHPLAFUZPFORF-SANMLTNESA-N |
| XLogP | 5.59 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|