C25H24N2O2 — CID 10548072
(3S)-3-benzyl-1-ethyl-5-(4-methoxyphenyl)-3H-1,4-benzodiazepin-2-one (PubChem CID 10548072) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is (3S)-3-benzyl-1-ethyl-5-(4-methoxyphenyl)-3H-1,4-benzodiazepin-2-one.
| Compound Name | (3S)-3-benzyl-1-ethyl-5-(4-methoxyphenyl)-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 10548072 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (3S)-3-benzyl-1-ethyl-5-(4-methoxyphenyl)-3H-1,4-benzodiazepin-2-one |
| SMILES | CCN1C(=O)[C@H](Cc2ccccc2)N=C(c2ccc(OC)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H24N2O2/c1-3-27-23-12-8-7-11-21(23)24(19-13-15-20(29-2)16-14-19)26-22(25(27)28)17-18-9-5-4-6-10-18/h4-16,22H,3,17H2,1-2H3/t22-/m0/s1 |
| InChIKey | UOPSTZPPRWBPMR-QFIPXVFZSA-N |
| XLogP | 4.51 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |