C31H23BrN4O5 — CID 98155022
2-(3-bromophenyl)-N-[(3S)-1-[2-(2-nitrophenyl)-2-oxoethyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]acetamide (PubChem CID 98155022) has the molecular formula C31H23BrN4O5 and a molecular weight of 611.45 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-[(3S)-1-[2-(2-nitrophenyl)-2-oxoethyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]acetamide.
| Compound Name | 2-(3-bromophenyl)-N-[(3S)-1-[2-(2-nitrophenyl)-2-oxoethyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]acetamide |
|---|---|
| PubChem CID | 98155022 |
| Molecular Formula | C31H23BrN4O5 |
| Molecular Weight | 611.45 g/mol |
| Exact Mass | 610.09 |
| IUPAC Name | 2-(3-bromophenyl)-N-[(3S)-1-[2-(2-nitrophenyl)-2-oxoethyl]-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]acetamide |
| SMILES | O=C(Cc1cccc(Br)c1)N[C@H]1N=C(c2ccccc2)c2ccccc2N(CC(=O)c2ccccc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C31H23BrN4O5/c32-22-12-8-9-20(17-22)18-28(38)33-30-31(39)35(19-27(37)23-13-4-7-16-26(23)36(40)41)25-15-6-5-14-24(25)29(34-30)21-10-2-1-3-11-21/h1-17,30H,18-19H2,(H,33,38)/t30-/m0/s1 |
| InChIKey | CFPIVPXNHPDGDA-PMERELPUSA-N |
| XLogP | 5.11 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|