C26H23N3O4 — CID 57396194
benzyl N-[2-oxo-1-(3-oxopropyl)-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamate (PubChem CID 57396194) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is benzyl N-[2-oxo-1-(3-oxopropyl)-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamate.
| Compound Name | benzyl N-[2-oxo-1-(3-oxopropyl)-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 57396194 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | benzyl N-[2-oxo-1-(3-oxopropyl)-5-phenyl-3H-1,4-benzodiazepin-3-yl]carbamate |
| SMILES | O=CCCN1C(=O)C(NC(=O)OCc2ccccc2)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H23N3O4/c30-17-9-16-29-22-15-8-7-14-21(22)23(20-12-5-2-6-13-20)27-24(25(29)31)28-26(32)33-18-19-10-3-1-4-11-19/h1-8,10-15,17,24H,9,16,18H2,(H,28,32) |
| InChIKey | NNTBEZJQQFBLKP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|