C26H24N2O3 — CID 10597782
benzyl 3-(3-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)propanoate (PubChem CID 10597782) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is benzyl 3-(3-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)propanoate.
| Compound Name | benzyl 3-(3-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)propanoate |
|---|---|
| PubChem CID | 10597782 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | benzyl 3-(3-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)propanoate |
| SMILES | CC1N=C(c2ccccc2)c2ccccc2N(CCC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C26H24N2O3/c1-19-26(30)28(17-16-24(29)31-18-20-10-4-2-5-11-20)23-15-9-8-14-22(23)25(27-19)21-12-6-3-7-13-21/h2-15,19H,16-18H2,1H3 |
| InChIKey | CBYUXSOUHHNAKN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |