C25H21N3O4 — CID 67799000
benzyl 12-hydroxy-13-oxo-10-phenyl-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraene-4-carboxylate (PubChem CID 67799000) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is benzyl 12-hydroxy-13-oxo-10-phenyl-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraene-4-carboxylate.
| Compound Name | benzyl 12-hydroxy-13-oxo-10-phenyl-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 67799000 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | benzyl 12-hydroxy-13-oxo-10-phenyl-1,4,11-triazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),10-tetraene-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN2C(=O)C(O)N=C(c3ccccc3)c3cccc1c32 |
| InChI | InChI=1S/C25H21N3O4/c29-23-24(30)28-15-14-27(25(31)32-16-17-8-3-1-4-9-17)20-13-7-12-19(22(20)28)21(26-23)18-10-5-2-6-11-18/h1-13,23,29H,14-16H2 |
| InChIKey | YYWFCCDHIJBZCV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |