C28H26N2O3 — CID 139670985
benzyl 2-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]pent-4-enoate (PubChem CID 139670985) has the molecular formula C28H26N2O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is benzyl 2-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]pent-4-enoate.
| Compound Name | benzyl 2-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]pent-4-enoate |
|---|---|
| PubChem CID | 139670985 |
| Molecular Formula | C28H26N2O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | benzyl 2-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]pent-4-enoate |
| SMILES | C=CCC(C(=O)OCc1ccccc1)[C@@H]1N=C(c2ccccc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C28H26N2O3/c1-3-12-23(28(32)33-19-20-13-6-4-7-14-20)26-27(31)30(2)24-18-11-10-17-22(24)25(29-26)21-15-8-5-9-16-21/h3-11,13-18,23,26H,1,12,19H2,2H3/t23?,26-/m0/s1 |
| InChIKey | LASQZWWXLRLHRG-NASUQTAISA-N |
| XLogP | 4.80 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|