C25H28N4O3 — CID 22135301
3-ethyl-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-2-prop-2-enylbutanediamide (PubChem CID 22135301) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-ethyl-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-2-prop-2-enylbutanediamide.
| Compound Name | 3-ethyl-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 22135301 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 3-ethyl-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)-2-prop-2-enylbutanediamide |
| SMILES | C=CCC(C(N)=O)C(CC)C(=O)NC1N=C(c2ccccc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C25H28N4O3/c1-4-11-18(22(26)30)17(5-2)24(31)28-23-25(32)29(3)20-15-10-9-14-19(20)21(27-23)16-12-7-6-8-13-16/h4,6-10,12-15,17-18,23H,1,5,11H2,2-3H3,(H2,26,30)(H,28,31) |
| InChIKey | AWFXVVBONWRDSU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|